C14H16ClF4NO — CID 106142634
N-(4-chloro-2,2-dimethylbutyl)-2-fluoro-3-(trifluoromethyl)benzamide (PubChem CID 106142634) has the molecular formula C14H16ClF4NO and a molecular weight of 325.73 g/mol. Its IUPAC name is N-(4-chloro-2,2-dimethylbutyl)-2-fluoro-3-(trifluoromethyl)benzamide.
| Compound Name | N-(4-chloro-2,2-dimethylbutyl)-2-fluoro-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 106142634 |
| Molecular Formula | C14H16ClF4NO |
| Molecular Weight | 325.73 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-(4-chloro-2,2-dimethylbutyl)-2-fluoro-3-(trifluoromethyl)benzamide |
| SMILES | CC(C)(CCCl)CNC(=O)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C14H16ClF4NO/c1-13(2,6-7-15)8-20-12(21)9-4-3-5-10(11(9)16)14(17,18)19/h3-5H,6-8H2,1-2H3,(H,20,21) |
| InChIKey | HDJWYQUSHHQLSY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.73 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|