C17H12F6N2O2 — CID 108542423
2,3,4-trifluoro-N-[2-[[2-(trifluoromethyl)benzoyl]amino]ethyl]benzamide (PubChem CID 108542423) has the molecular formula C17H12F6N2O2 and a molecular weight of 390.28 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[2-[[2-(trifluoromethyl)benzoyl]amino]ethyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[2-[[2-(trifluoromethyl)benzoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108542423 |
| Molecular Formula | C17H12F6N2O2 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 2,3,4-trifluoro-N-[2-[[2-(trifluoromethyl)benzoyl]amino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccc(F)c(F)c1F)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H12F6N2O2/c18-12-6-5-10(13(19)14(12)20)16(27)25-8-7-24-15(26)9-3-1-2-4-11(9)17(21,22)23/h1-6H,7-8H2,(H,24,26)(H,25,27) |
| InChIKey | KCBWKXVYQBXKNI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|