C12H15NO3 — CID 114344475
N-(2-cyclopropylethyl)-2,3-dihydroxybenzamide (PubChem CID 114344475) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is N-(2-cyclopropylethyl)-2,3-dihydroxybenzamide.
| Compound Name | N-(2-cyclopropylethyl)-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114344475 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N-(2-cyclopropylethyl)-2,3-dihydroxybenzamide |
| SMILES | O=C(NCCC1CC1)c1cccc(O)c1O |
| InChI | InChI=1S/C12H15NO3/c14-10-3-1-2-9(11(10)15)12(16)13-7-6-8-4-5-8/h1-3,8,14-15H,4-7H2,(H,13,16) |
| InChIKey | DYCPOHCDKHXJSY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|