C14H19NO3 — CID 56679854
N-(cyclohexylmethyl)-2,3-dihydroxybenzamide (PubChem CID 56679854) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2,3-dihydroxybenzamide.
| Compound Name | N-(cyclohexylmethyl)-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 56679854 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-(cyclohexylmethyl)-2,3-dihydroxybenzamide |
| SMILES | O=C(NCC1CCCCC1)c1cccc(O)c1O |
| InChI | InChI=1S/C14H19NO3/c16-12-8-4-7-11(13(12)17)14(18)15-9-10-5-2-1-3-6-10/h4,7-8,10,16-17H,1-3,5-6,9H2,(H,15,18) |
| InChIKey | SPRQDHZLXJCZBJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|