C14H17Cl2NO — CID 23019884
2,3-dichloro-N-(cyclohexylmethyl)benzamide (PubChem CID 23019884) has the molecular formula C14H17Cl2NO and a molecular weight of 286.20 g/mol. Its IUPAC name is 2,3-dichloro-N-(cyclohexylmethyl)benzamide.
| Compound Name | 2,3-dichloro-N-(cyclohexylmethyl)benzamide |
|---|---|
| PubChem CID | 23019884 |
| Molecular Formula | C14H17Cl2NO |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2,3-dichloro-N-(cyclohexylmethyl)benzamide |
| SMILES | O=C(NCC1CCCCC1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H17Cl2NO/c15-12-8-4-7-11(13(12)16)14(18)17-9-10-5-2-1-3-6-10/h4,7-8,10H,1-3,5-6,9H2,(H,17,18) |
| InChIKey | FPUFOIAMIMEVKC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |