C12H13BrClNO — CID 103988581
3-bromo-2-chloro-N-(cyclobutylmethyl)benzamide (PubChem CID 103988581) has the molecular formula C12H13BrClNO and a molecular weight of 302.60 g/mol. Its IUPAC name is 3-bromo-2-chloro-N-(cyclobutylmethyl)benzamide.
| Compound Name | 3-bromo-2-chloro-N-(cyclobutylmethyl)benzamide |
|---|---|
| PubChem CID | 103988581 |
| Molecular Formula | C12H13BrClNO |
| Molecular Weight | 302.60 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 3-bromo-2-chloro-N-(cyclobutylmethyl)benzamide |
| SMILES | O=C(NCC1CCC1)c1cccc(Br)c1Cl |
| InChI | InChI=1S/C12H13BrClNO/c13-10-6-2-5-9(11(10)14)12(16)15-7-8-3-1-4-8/h2,5-6,8H,1,3-4,7H2,(H,15,16) |
| InChIKey | NRXONKIFKAOENU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.60 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |