C14H17BrClNO2 — CID 103995768
3-bromo-2-chloro-N-(2-cyclopentyloxyethyl)benzamide (PubChem CID 103995768) has the molecular formula C14H17BrClNO2 and a molecular weight of 346.65 g/mol. Its IUPAC name is 3-bromo-2-chloro-N-(2-cyclopentyloxyethyl)benzamide.
| Compound Name | 3-bromo-2-chloro-N-(2-cyclopentyloxyethyl)benzamide |
|---|---|
| PubChem CID | 103995768 |
| Molecular Formula | C14H17BrClNO2 |
| Molecular Weight | 346.65 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 3-bromo-2-chloro-N-(2-cyclopentyloxyethyl)benzamide |
| SMILES | O=C(NCCOC1CCCC1)c1cccc(Br)c1Cl |
| InChI | InChI=1S/C14H17BrClNO2/c15-12-7-3-6-11(13(12)16)14(18)17-8-9-19-10-4-1-2-5-10/h3,6-7,10H,1-2,4-5,8-9H2,(H,17,18) |
| InChIKey | LDLBPBBDTGOAER-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.65 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|