C13H15F2NO — CID 62649354
N-(cyclopentylmethyl)-2,3-difluorobenzamide (PubChem CID 62649354) has the molecular formula C13H15F2NO and a molecular weight of 239.26 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-2,3-difluorobenzamide.
| Compound Name | N-(cyclopentylmethyl)-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 62649354 |
| Molecular Formula | C13H15F2NO |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-(cyclopentylmethyl)-2,3-difluorobenzamide |
| SMILES | O=C(NCC1CCCC1)c1cccc(F)c1F |
| InChI | InChI=1S/C13H15F2NO/c14-11-7-3-6-10(12(11)15)13(17)16-8-9-4-1-2-5-9/h3,6-7,9H,1-2,4-5,8H2,(H,16,17) |
| InChIKey | JURSPPSCAPYNGX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |