C14H19FN2O — CID 62660297
N-(cyclopentylmethyl)-3-fluoro-2-(methylamino)benzamide (PubChem CID 62660297) has the molecular formula C14H19FN2O and a molecular weight of 250.32 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-3-fluoro-2-(methylamino)benzamide.
| Compound Name | N-(cyclopentylmethyl)-3-fluoro-2-(methylamino)benzamide |
|---|---|
| PubChem CID | 62660297 |
| Molecular Formula | C14H19FN2O |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | N-(cyclopentylmethyl)-3-fluoro-2-(methylamino)benzamide |
| SMILES | CNc1c(F)cccc1C(=O)NCC1CCCC1 |
| InChI | InChI=1S/C14H19FN2O/c1-16-13-11(7-4-8-12(13)15)14(18)17-9-10-5-2-3-6-10/h4,7-8,10,16H,2-3,5-6,9H2,1H3,(H,17,18) |
| InChIKey | RURWCRGVPWDRRW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |