C15H19F2NO — CID 62660422
2,3-difluoro-N-[(2-methylcyclohexyl)methyl]benzamide (PubChem CID 62660422) has the molecular formula C15H19F2NO and a molecular weight of 267.32 g/mol. Its IUPAC name is 2,3-difluoro-N-[(2-methylcyclohexyl)methyl]benzamide.
| Compound Name | 2,3-difluoro-N-[(2-methylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 62660422 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2,3-difluoro-N-[(2-methylcyclohexyl)methyl]benzamide |
| SMILES | CC1CCCCC1CNC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C15H19F2NO/c1-10-5-2-3-6-11(10)9-18-15(19)12-7-4-8-13(16)14(12)17/h4,7-8,10-11H,2-3,5-6,9H2,1H3,(H,18,19) |
| InChIKey | NBEQYQRONSAMID-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |