C16H22FNO — CID 62512195
2-fluoro-5-methyl-N-[(2-methylcyclohexyl)methyl]benzamide (PubChem CID 62512195) has the molecular formula C16H22FNO and a molecular weight of 263.36 g/mol. Its IUPAC name is 2-fluoro-5-methyl-N-[(2-methylcyclohexyl)methyl]benzamide.
| Compound Name | 2-fluoro-5-methyl-N-[(2-methylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 62512195 |
| Molecular Formula | C16H22FNO |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 2-fluoro-5-methyl-N-[(2-methylcyclohexyl)methyl]benzamide |
| SMILES | Cc1ccc(F)c(C(=O)NCC2CCCCC2C)c1 |
| InChI | InChI=1S/C16H22FNO/c1-11-7-8-15(17)14(9-11)16(19)18-10-13-6-4-3-5-12(13)2/h7-9,12-13H,3-6,10H2,1-2H3,(H,18,19) |
| InChIKey | BZGBRAIPQHGYMW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |