C17H24FNO — CID 81480761
N-[(4-ethylcyclohexyl)methyl]-2-fluoro-3-methylbenzamide (PubChem CID 81480761) has the molecular formula C17H24FNO and a molecular weight of 277.38 g/mol. Its IUPAC name is N-[(4-ethylcyclohexyl)methyl]-2-fluoro-3-methylbenzamide.
| Compound Name | N-[(4-ethylcyclohexyl)methyl]-2-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 81480761 |
| Molecular Formula | C17H24FNO |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-[(4-ethylcyclohexyl)methyl]-2-fluoro-3-methylbenzamide |
| SMILES | CCC1CCC(CNC(=O)c2cccc(C)c2F)CC1 |
| InChI | InChI=1S/C17H24FNO/c1-3-13-7-9-14(10-8-13)11-19-17(20)15-6-4-5-12(2)16(15)18/h4-6,13-14H,3,7-11H2,1-2H3,(H,19,20) |
| InChIKey | CNSPQJXSJJNBFQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |