C16H20F3NO — CID 63482414
N-[(4-ethylcyclohexyl)methyl]-3,4,5-trifluorobenzamide (PubChem CID 63482414) has the molecular formula C16H20F3NO and a molecular weight of 299.34 g/mol. Its IUPAC name is N-[(4-ethylcyclohexyl)methyl]-3,4,5-trifluorobenzamide.
| Compound Name | N-[(4-ethylcyclohexyl)methyl]-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 63482414 |
| Molecular Formula | C16H20F3NO |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | N-[(4-ethylcyclohexyl)methyl]-3,4,5-trifluorobenzamide |
| SMILES | CCC1CCC(CNC(=O)c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C16H20F3NO/c1-2-10-3-5-11(6-4-10)9-20-16(21)12-7-13(17)15(19)14(18)8-12/h7-8,10-11H,2-6,9H2,1H3,(H,20,21) |
| InChIKey | XUMGJPIYVHDISS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|