C16H21F2NO2 — CID 63537188
4-[(4-ethylcyclohexyl)methylamino]-3,5-difluorobenzoic acid (PubChem CID 63537188) has the molecular formula C16H21F2NO2 and a molecular weight of 297.34 g/mol. Its IUPAC name is 4-[(4-ethylcyclohexyl)methylamino]-3,5-difluorobenzoic acid.
| Compound Name | 4-[(4-ethylcyclohexyl)methylamino]-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 63537188 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-[(4-ethylcyclohexyl)methylamino]-3,5-difluorobenzoic acid |
| SMILES | CCC1CCC(CNc2c(F)cc(C(=O)O)cc2F)CC1 |
| InChI | InChI=1S/C16H21F2NO2/c1-2-10-3-5-11(6-4-10)9-19-15-13(17)7-12(16(20)21)8-14(15)18/h7-8,10-11,19H,2-6,9H2,1H3,(H,20,21) |
| InChIKey | GUUHIUBSLVAOFO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |