C12H13FO4S — CID 43560570
3-(cyclopropylmethylsulfonyl)-5-fluoro-4-methylbenzoic acid (PubChem CID 43560570) has the molecular formula C12H13FO4S and a molecular weight of 272.30 g/mol. Its IUPAC name is 3-(cyclopropylmethylsulfonyl)-5-fluoro-4-methylbenzoic acid.
| Compound Name | 3-(cyclopropylmethylsulfonyl)-5-fluoro-4-methylbenzoic acid |
|---|---|
| PubChem CID | 43560570 |
| Molecular Formula | C12H13FO4S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 3-(cyclopropylmethylsulfonyl)-5-fluoro-4-methylbenzoic acid |
| SMILES | Cc1c(F)cc(C(=O)O)cc1S(=O)(=O)CC1CC1 |
| InChI | InChI=1S/C12H13FO4S/c1-7-10(13)4-9(12(14)15)5-11(7)18(16,17)6-8-2-3-8/h4-5,8H,2-3,6H2,1H3,(H,14,15) |
| InChIKey | GOVHRUAWNRFPMR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |