C10H10F2N2O3 — CID 63187608
3,5-difluoro-4-[[2-(methylamino)-2-oxoethyl]amino]benzoic acid (PubChem CID 63187608) has the molecular formula C10H10F2N2O3 and a molecular weight of 244.20 g/mol. Its IUPAC name is 3,5-difluoro-4-[[2-(methylamino)-2-oxoethyl]amino]benzoic acid.
| Compound Name | 3,5-difluoro-4-[[2-(methylamino)-2-oxoethyl]amino]benzoic acid |
|---|---|
| PubChem CID | 63187608 |
| Molecular Formula | C10H10F2N2O3 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3,5-difluoro-4-[[2-(methylamino)-2-oxoethyl]amino]benzoic acid |
| SMILES | CNC(=O)CNc1c(F)cc(C(=O)O)cc1F |
| InChI | InChI=1S/C10H10F2N2O3/c1-13-8(15)4-14-9-6(11)2-5(10(16)17)3-7(9)12/h2-3,14H,4H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | HFZYZSCVVWKVMP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |