3,5-difluoro-4-(2-methoxypropylamino)benzoic acid

C11H13F2NO3 — CID 102698532

IUPAC3,5-difluoro-4-(2-methoxypropylamino)benzoic acid
SMILESCOC(C)CNc1c(F)cc(C(=O)O)cc1F
InChIInChI=1S/C11H13F2NO3/c1-6(17-2)5-14-10-8(12)3-7(11(15)16)4-9(10)13/h3-4,6,14H,5H2,1-2H3,(H,15,16)
InChIKeySJZPKYXRZVWAOX-UHFFFAOYSA-N
MW245.22 g/mol
LogP2.11
Rot. Bonds5

About 3,5-difluoro-4-(2-methoxypropylamino)benzoic acid

3,5-difluoro-4-(2-methoxypropylamino)benzoic acid (PubChem CID 102698532) has the molecular formula C11H13F2NO3 and a molecular weight of 245.22 g/mol. Its IUPAC name is 3,5-difluoro-4-(2-methoxypropylamino)benzoic acid.

Molecular Properties

Compound Name3,5-difluoro-4-(2-methoxypropylamino)benzoic acid
PubChem CID102698532
Molecular FormulaC11H13F2NO3
Molecular Weight245.22 g/mol
Exact Mass245.09
IUPAC Name3,5-difluoro-4-(2-methoxypropylamino)benzoic acid
SMILESCOC(C)CNc1c(F)cc(C(=O)O)cc1F
InChIInChI=1S/C11H13F2NO3/c1-6(17-2)5-14-10-8(12)3-7(11(15)16)4-9(10)13/h3-4,6,14H,5H2,1-2H3,(H,15,16)
InChIKeySJZPKYXRZVWAOX-UHFFFAOYSA-N
XLogP2.11
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.22
LogP ≤ 52.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3,5-difluoro-4-(2-methoxypropylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-difluoro-4-(2-methoxypropylamino)benzoic acid?
The IUPAC name of 3,5-difluoro-4-(2-methoxypropylamino)benzoic acid (CID 102698532) is 3,5-difluoro-4-(2-methoxypropylamino)benzoic acid.
What is the SMILES notation for 3,5-difluoro-4-(2-methoxypropylamino)benzoic acid?
The canonical SMILES for 3,5-difluoro-4-(2-methoxypropylamino)benzoic acid is COC(C)CNc1c(F)cc(C(=O)O)cc1F.
What is the InChIKey of 3,5-difluoro-4-(2-methoxypropylamino)benzoic acid?
The InChIKey is SJZPKYXRZVWAOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NO3/c1-6(17-2)5-14-10-8(12)3-7(11(15)16)4-9(10)13/h3-4,6,14H,5H2,1-2H3,(H,15,16).
What are the key properties of 3,5-difluoro-4-(2-methoxypropylamino)benzoic acid?
3,5-difluoro-4-(2-methoxypropylamino)benzoic acid has a molecular weight of 245.22 g/mol, XLogP of 2.11, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluoro-4-(2-methoxypropylamino)benzoic acid is sourced from PubChem (CID 102698532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).