C12H15F2N3OS — CID 81286543
2-(4-carbamothioyl-2,6-difluoroanilino)-N-propan-2-ylacetamide (PubChem CID 81286543) has the molecular formula C12H15F2N3OS and a molecular weight of 287.33 g/mol. Its IUPAC name is 2-(4-carbamothioyl-2,6-difluoroanilino)-N-propan-2-ylacetamide.
| Compound Name | 2-(4-carbamothioyl-2,6-difluoroanilino)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 81286543 |
| Molecular Formula | C12H15F2N3OS |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-(4-carbamothioyl-2,6-difluoroanilino)-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CNc1c(F)cc(C(N)=S)cc1F |
| InChI | InChI=1S/C12H15F2N3OS/c1-6(2)17-10(18)5-16-11-8(13)3-7(12(15)19)4-9(11)14/h3-4,6,16H,5H2,1-2H3,(H2,15,19)(H,17,18) |
| InChIKey | GVRJHXLQMRXDHL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|