C14H20F2N2S — CID 81286665
4-(3-ethylpentan-3-ylamino)-3,5-difluorobenzenecarbothioamide (PubChem CID 81286665) has the molecular formula C14H20F2N2S and a molecular weight of 286.39 g/mol. Its IUPAC name is 4-(3-ethylpentan-3-ylamino)-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-(3-ethylpentan-3-ylamino)-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 81286665 |
| Molecular Formula | C14H20F2N2S |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 4-(3-ethylpentan-3-ylamino)-3,5-difluorobenzenecarbothioamide |
| SMILES | CCC(CC)(CC)Nc1c(F)cc(C(N)=S)cc1F |
| InChI | InChI=1S/C14H20F2N2S/c1-4-14(5-2,6-3)18-12-10(15)7-9(13(17)19)8-11(12)16/h7-8,18H,4-6H2,1-3H3,(H2,17,19) |
| InChIKey | LSXBHSOPCKYRDY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|