C10H12F2N2S — CID 81286537
4-[ethyl(methyl)amino]-3,5-difluorobenzenecarbothioamide (PubChem CID 81286537) has the molecular formula C10H12F2N2S and a molecular weight of 230.28 g/mol. Its IUPAC name is 4-[ethyl(methyl)amino]-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-[ethyl(methyl)amino]-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 81286537 |
| Molecular Formula | C10H12F2N2S |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 4-[ethyl(methyl)amino]-3,5-difluorobenzenecarbothioamide |
| SMILES | CCN(C)c1c(F)cc(C(N)=S)cc1F |
| InChI | InChI=1S/C10H12F2N2S/c1-3-14(2)9-7(11)4-6(10(13)15)5-8(9)12/h4-5H,3H2,1-2H3,(H2,13,15) |
| InChIKey | HNACRJQBVRUXMG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|