C13H18F2N2O2S — CID 81286261
4-[bis(2-methoxyethyl)amino]-3,5-difluorobenzenecarbothioamide (PubChem CID 81286261) has the molecular formula C13H18F2N2O2S and a molecular weight of 304.36 g/mol. Its IUPAC name is 4-[bis(2-methoxyethyl)amino]-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-[bis(2-methoxyethyl)amino]-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 81286261 |
| Molecular Formula | C13H18F2N2O2S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-[bis(2-methoxyethyl)amino]-3,5-difluorobenzenecarbothioamide |
| SMILES | COCCN(CCOC)c1c(F)cc(C(N)=S)cc1F |
| InChI | InChI=1S/C13H18F2N2O2S/c1-18-5-3-17(4-6-19-2)12-10(14)7-9(13(16)20)8-11(12)15/h7-8H,3-6H2,1-2H3,(H2,16,20) |
| InChIKey | OYCCOOLHLWTNNM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|