About 2,6-difluoro-1-N-(2-methoxyethyl)-1-N-(3-methoxypropyl)benzene-1,4-diamine
2,6-difluoro-1-N-(2-methoxyethyl)-1-N-(3-methoxypropyl)benzene-1,4-diamine (PubChem CID 54985046) has the molecular formula C13H20F2N2O2
and a molecular weight of 274.31 g/mol. Its IUPAC name is 2,6-difluoro-1-N-(2-methoxyethyl)-1-N-(3-methoxypropyl)benzene-1,4-diamine.
Molecular Properties
| Compound Name | 2,6-difluoro-1-N-(2-methoxyethyl)-1-N-(3-methoxypropyl)benzene-1,4-diamine |
| PubChem CID | 54985046 |
| Molecular Formula | C13H20F2N2O2 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 2,6-difluoro-1-N-(2-methoxyethyl)-1-N-(3-methoxypropyl)benzene-1,4-diamine |
| SMILES | COCCCN(CCOC)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C13H20F2N2O2/c1-18-6-3-4-17(5-7-19-2)13-11(14)8-10(16)9-12(13)15/h8-9H,3-7,16H2,1-2H3 |
| InChIKey | CILGPVUVOLRAMC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,6-difluoro-1-N-(2-methoxyethyl)-1-N-(3-methoxypropyl)benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-difluoro-1-N-(2-methoxyethyl)-1-N-(3-methoxypropyl)benzene-1,4-diamine?
The IUPAC name of 2,6-difluoro-1-N-(2-methoxyethyl)-1-N-(3-methoxypropyl)benzene-1,4-diamine (CID 54985046) is 2,6-difluoro-1-N-(2-methoxyethyl)-1-N-(3-methoxypropyl)benzene-1,4-diamine.
What is the SMILES notation for 2,6-difluoro-1-N-(2-methoxyethyl)-1-N-(3-methoxypropyl)benzene-1,4-diamine?
The canonical SMILES for 2,6-difluoro-1-N-(2-methoxyethyl)-1-N-(3-methoxypropyl)benzene-1,4-diamine is COCCCN(CCOC)c1c(F)cc(N)cc1F.
What is the InChIKey of 2,6-difluoro-1-N-(2-methoxyethyl)-1-N-(3-methoxypropyl)benzene-1,4-diamine?
The InChIKey is CILGPVUVOLRAMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F2N2O2/c1-18-6-3-4-17(5-7-19-2)13-11(14)8-10(16)9-12(13)15/h8-9H,3-7,16H2,1-2H3.
What are the key properties of 2,6-difluoro-1-N-(2-methoxyethyl)-1-N-(3-methoxypropyl)benzene-1,4-diamine?
2,6-difluoro-1-N-(2-methoxyethyl)-1-N-(3-methoxypropyl)benzene-1,4-diamine has a molecular weight of 274.31 g/mol, XLogP of 2.04, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluoro-1-N-(2-methoxyethyl)-1-N-(3-methoxypropyl)benzene-1,4-diamine is sourced from PubChem (CID 54985046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).