C12H18F2N2O2 — CID 62531981
3,4-difluoro-2-N,2-N-bis(2-methoxyethyl)benzene-1,2-diamine (PubChem CID 62531981) has the molecular formula C12H18F2N2O2 and a molecular weight of 260.28 g/mol. Its IUPAC name is 3,4-difluoro-2-N,2-N-bis(2-methoxyethyl)benzene-1,2-diamine.
| Compound Name | 3,4-difluoro-2-N,2-N-bis(2-methoxyethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 62531981 |
| Molecular Formula | C12H18F2N2O2 |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3,4-difluoro-2-N,2-N-bis(2-methoxyethyl)benzene-1,2-diamine |
| SMILES | COCCN(CCOC)c1c(N)ccc(F)c1F |
| InChI | InChI=1S/C12H18F2N2O2/c1-17-7-5-16(6-8-18-2)12-10(15)4-3-9(13)11(12)14/h3-4H,5-8,15H2,1-2H3 |
| InChIKey | TVAHUMLURXVYHZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|