C10H14F2N2 — CID 62533650
3,4-difluoro-2-N-methyl-2-N-propan-2-ylbenzene-1,2-diamine (PubChem CID 62533650) has the molecular formula C10H14F2N2 and a molecular weight of 200.23 g/mol. Its IUPAC name is 3,4-difluoro-2-N-methyl-2-N-propan-2-ylbenzene-1,2-diamine.
| Compound Name | 3,4-difluoro-2-N-methyl-2-N-propan-2-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 62533650 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 3,4-difluoro-2-N-methyl-2-N-propan-2-ylbenzene-1,2-diamine |
| SMILES | CC(C)N(C)c1c(N)ccc(F)c1F |
| InChI | InChI=1S/C10H14F2N2/c1-6(2)14(3)10-8(13)5-4-7(11)9(10)12/h4-6H,13H2,1-3H3 |
| InChIKey | KSGAYXYBBCJRMS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|