C11H16F2N2O — CID 81059459
2-N-(2-ethoxyethyl)-3,4-difluoro-2-N-methylbenzene-1,2-diamine (PubChem CID 81059459) has the molecular formula C11H16F2N2O and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-N-(2-ethoxyethyl)-3,4-difluoro-2-N-methylbenzene-1,2-diamine.
| Compound Name | 2-N-(2-ethoxyethyl)-3,4-difluoro-2-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 81059459 |
| Molecular Formula | C11H16F2N2O |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-N-(2-ethoxyethyl)-3,4-difluoro-2-N-methylbenzene-1,2-diamine |
| SMILES | CCOCCN(C)c1c(N)ccc(F)c1F |
| InChI | InChI=1S/C11H16F2N2O/c1-3-16-7-6-15(2)11-9(14)5-4-8(12)10(11)13/h4-5H,3,6-7,14H2,1-2H3 |
| InChIKey | OJFJDNDLDSIHRP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|