C12H15F2NO3 — CID 81055654
4-[2-ethoxyethyl(methyl)amino]-3,5-difluorobenzoic acid (PubChem CID 81055654) has the molecular formula C12H15F2NO3 and a molecular weight of 259.25 g/mol. Its IUPAC name is 4-[2-ethoxyethyl(methyl)amino]-3,5-difluorobenzoic acid.
| Compound Name | 4-[2-ethoxyethyl(methyl)amino]-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 81055654 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 4-[2-ethoxyethyl(methyl)amino]-3,5-difluorobenzoic acid |
| SMILES | CCOCCN(C)c1c(F)cc(C(=O)O)cc1F |
| InChI | InChI=1S/C12H15F2NO3/c1-3-18-5-4-15(2)11-9(13)6-8(12(16)17)7-10(11)14/h6-7H,3-5H2,1-2H3,(H,16,17) |
| InChIKey | NUHFZPKPJBPKIH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|