C13H14F2O5 — CID 69291127
4-[2-(2-ethoxyethoxy)-2-oxoethyl]-3,5-difluorobenzoic acid (PubChem CID 69291127) has the molecular formula C13H14F2O5 and a molecular weight of 288.25 g/mol. Its IUPAC name is 4-[2-(2-ethoxyethoxy)-2-oxoethyl]-3,5-difluorobenzoic acid.
| Compound Name | 4-[2-(2-ethoxyethoxy)-2-oxoethyl]-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 69291127 |
| Molecular Formula | C13H14F2O5 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 4-[2-(2-ethoxyethoxy)-2-oxoethyl]-3,5-difluorobenzoic acid |
| SMILES | CCOCCOC(=O)Cc1c(F)cc(C(=O)O)cc1F |
| InChI | InChI=1S/C13H14F2O5/c1-2-19-3-4-20-12(16)7-9-10(14)5-8(13(17)18)6-11(9)15/h5-6H,2-4,7H2,1H3,(H,17,18) |
| InChIKey | YWUBXQWWXGIQJO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|