C13H12F2O4 — CID 170796683
4-(4-ethoxy-4-oxobut-1-enyl)-3,5-difluorobenzoic acid (PubChem CID 170796683) has the molecular formula C13H12F2O4 and a molecular weight of 270.23 g/mol. Its IUPAC name is 4-(4-ethoxy-4-oxobut-1-enyl)-3,5-difluorobenzoic acid.
| Compound Name | 4-(4-ethoxy-4-oxobut-1-enyl)-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 170796683 |
| Molecular Formula | C13H12F2O4 |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-(4-ethoxy-4-oxobut-1-enyl)-3,5-difluorobenzoic acid |
| SMILES | CCOC(=O)CC=Cc1c(F)cc(C(=O)O)cc1F |
| InChI | InChI=1S/C13H12F2O4/c1-2-19-12(16)5-3-4-9-10(14)6-8(13(17)18)7-11(9)15/h3-4,6-7H,2,5H2,1H3,(H,17,18) |
| InChIKey | HKHDMDHIXQFZIG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |