C14H13F3O4 — CID 170797046
2-(4-ethoxy-4-oxobut-1-enyl)-5-(trifluoromethyl)benzoic acid (PubChem CID 170797046) has the molecular formula C14H13F3O4 and a molecular weight of 302.25 g/mol. Its IUPAC name is 2-(4-ethoxy-4-oxobut-1-enyl)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(4-ethoxy-4-oxobut-1-enyl)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 170797046 |
| Molecular Formula | C14H13F3O4 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-(4-ethoxy-4-oxobut-1-enyl)-5-(trifluoromethyl)benzoic acid |
| SMILES | CCOC(=O)CC=Cc1ccc(C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C14H13F3O4/c1-2-21-12(18)5-3-4-9-6-7-10(14(15,16)17)8-11(9)13(19)20/h3-4,6-8H,2,5H2,1H3,(H,19,20) |
| InChIKey | MXDNVEYMXVGVEV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |