C13H13F3O3 — CID 170796694
ethyl 4-[3-hydroxy-5-(trifluoromethyl)phenyl]but-3-enoate (PubChem CID 170796694) has the molecular formula C13H13F3O3 and a molecular weight of 274.24 g/mol. Its IUPAC name is ethyl 4-[3-hydroxy-5-(trifluoromethyl)phenyl]but-3-enoate.
| Compound Name | ethyl 4-[3-hydroxy-5-(trifluoromethyl)phenyl]but-3-enoate |
|---|---|
| PubChem CID | 170796694 |
| Molecular Formula | C13H13F3O3 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | ethyl 4-[3-hydroxy-5-(trifluoromethyl)phenyl]but-3-enoate |
| SMILES | CCOC(=O)CC=Cc1cc(O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F3O3/c1-2-19-12(18)5-3-4-9-6-10(13(14,15)16)8-11(17)7-9/h3-4,6-8,17H,2,5H2,1H3 |
| InChIKey | QZLXGXREYSBZCA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |