C21H22F6O4 — CID 24881492
diethyl 2-[(E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enyl]-2-prop-2-enylpropanedioate (PubChem CID 24881492) has the molecular formula C21H22F6O4 and a molecular weight of 452.39 g/mol. Its IUPAC name is diethyl 2-[(E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enyl]-2-prop-2-enylpropanedioate.
| Compound Name | diethyl 2-[(E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enyl]-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 24881492 |
| Molecular Formula | C21H22F6O4 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | diethyl 2-[(E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enyl]-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(C/C=C/c1cc(C(F)(F)F)cc(C(F)(F)F)c1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C21H22F6O4/c1-4-9-19(17(28)30-5-2,18(29)31-6-3)10-7-8-14-11-15(20(22,23)24)13-16(12-14)21(25,26)27/h4,7-8,11-13H,1,5-6,9-10H2,2-3H3/b8-7+ |
| InChIKey | UXHRCJXFJOAGOE-BQYQJAHWSA-N |
| XLogP | 5.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|