C16H19FO4 — CID 103973170
diethyl 2-(4-fluorophenyl)-2-prop-2-enylpropanedioate (PubChem CID 103973170) has the molecular formula C16H19FO4 and a molecular weight of 294.32 g/mol. Its IUPAC name is diethyl 2-(4-fluorophenyl)-2-prop-2-enylpropanedioate.
| Compound Name | diethyl 2-(4-fluorophenyl)-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 103973170 |
| Molecular Formula | C16H19FO4 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | diethyl 2-(4-fluorophenyl)-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(C(=O)OCC)(C(=O)OCC)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H19FO4/c1-4-11-16(14(18)20-5-2,15(19)21-6-3)12-7-9-13(17)10-8-12/h4,7-10H,1,5-6,11H2,2-3H3 |
| InChIKey | QTMOOYMPDNFDIF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|