C14H14F4O2S — CID 126961913
ethyl 2-(4-fluorophenyl)-2-(trifluoromethylsulfanyl)pent-4-enoate (PubChem CID 126961913) has the molecular formula C14H14F4O2S and a molecular weight of 322.32 g/mol. Its IUPAC name is ethyl 2-(4-fluorophenyl)-2-(trifluoromethylsulfanyl)pent-4-enoate.
| Compound Name | ethyl 2-(4-fluorophenyl)-2-(trifluoromethylsulfanyl)pent-4-enoate |
|---|---|
| PubChem CID | 126961913 |
| Molecular Formula | C14H14F4O2S |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | ethyl 2-(4-fluorophenyl)-2-(trifluoromethylsulfanyl)pent-4-enoate |
| SMILES | C=CCC(SC(F)(F)F)(C(=O)OCC)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H14F4O2S/c1-3-9-13(12(19)20-4-2,21-14(16,17)18)10-5-7-11(15)8-6-10/h3,5-8H,1,4,9H2,2H3 |
| InChIKey | MHUKOHWGBJPVAG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|