C14H16F2O2 — CID 117049214
ethyl 2-(3,4-difluorophenyl)-2-methylpent-4-enoate (PubChem CID 117049214) has the molecular formula C14H16F2O2 and a molecular weight of 254.28 g/mol. Its IUPAC name is ethyl 2-(3,4-difluorophenyl)-2-methylpent-4-enoate.
| Compound Name | ethyl 2-(3,4-difluorophenyl)-2-methylpent-4-enoate |
|---|---|
| PubChem CID | 117049214 |
| Molecular Formula | C14H16F2O2 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | ethyl 2-(3,4-difluorophenyl)-2-methylpent-4-enoate |
| SMILES | C=CCC(C)(C(=O)OCC)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H16F2O2/c1-4-8-14(3,13(17)18-5-2)10-6-7-11(15)12(16)9-10/h4,6-7,9H,1,5,8H2,2-3H3 |
| InChIKey | NLLRBPDDGKBSFV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|