C13H14Cl2O2 — CID 135044392
methyl (2R)-2-(3,4-dichlorophenyl)-2-methylpent-4-enoate (PubChem CID 135044392) has the molecular formula C13H14Cl2O2 and a molecular weight of 273.16 g/mol. Its IUPAC name is methyl (2R)-2-(3,4-dichlorophenyl)-2-methylpent-4-enoate.
| Compound Name | methyl (2R)-2-(3,4-dichlorophenyl)-2-methylpent-4-enoate |
|---|---|
| PubChem CID | 135044392 |
| Molecular Formula | C13H14Cl2O2 |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | methyl (2R)-2-(3,4-dichlorophenyl)-2-methylpent-4-enoate |
| SMILES | C=CC[C@@](C)(C(=O)OC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H14Cl2O2/c1-4-7-13(2,12(16)17-3)9-5-6-10(14)11(15)8-9/h4-6,8H,1,7H2,2-3H3/t13-/m1/s1 |
| InChIKey | CIFSNMZGSZEKJQ-CYBMUJFWSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|