C10H11Cl2NO2 — CID 93311074
methyl (2S)-2-amino-2-(3,4-dichlorophenyl)propanoate (PubChem CID 93311074) has the molecular formula C10H11Cl2NO2 and a molecular weight of 248.11 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-(3,4-dichlorophenyl)propanoate.
| Compound Name | methyl (2S)-2-amino-2-(3,4-dichlorophenyl)propanoate |
|---|---|
| PubChem CID | 93311074 |
| Molecular Formula | C10H11Cl2NO2 |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | methyl (2S)-2-amino-2-(3,4-dichlorophenyl)propanoate |
| SMILES | COC(=O)[C@@](C)(N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H11Cl2NO2/c1-10(13,9(14)15-2)6-3-4-7(11)8(12)5-6/h3-5H,13H2,1-2H3/t10-/m0/s1 |
| InChIKey | BYWKSTSGBJNLMJ-JTQLQIEISA-N |
| XLogP | 2.34 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |