C14H19Cl2NO3 — CID 57032280
tert-butyl N-[2-(3,4-dichlorophenyl)-2-hydroxypropyl]carbamate (PubChem CID 57032280) has the molecular formula C14H19Cl2NO3 and a molecular weight of 320.22 g/mol. Its IUPAC name is tert-butyl N-[2-(3,4-dichlorophenyl)-2-hydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[2-(3,4-dichlorophenyl)-2-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 57032280 |
| Molecular Formula | C14H19Cl2NO3 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | tert-butyl N-[2-(3,4-dichlorophenyl)-2-hydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(C)(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H19Cl2NO3/c1-13(2,3)20-12(18)17-8-14(4,19)9-5-6-10(15)11(16)7-9/h5-7,19H,8H2,1-4H3,(H,17,18) |
| InChIKey | VRECDOCIUGWDKZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |