C10H12Cl2O — CID 94471655
(2S)-2-(3,4-dichlorophenyl)butan-2-ol (PubChem CID 94471655) has the molecular formula C10H12Cl2O and a molecular weight of 219.11 g/mol. Its IUPAC name is (2S)-2-(3,4-dichlorophenyl)butan-2-ol.
| Compound Name | (2S)-2-(3,4-dichlorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 94471655 |
| Molecular Formula | C10H12Cl2O |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | (2S)-2-(3,4-dichlorophenyl)butan-2-ol |
| SMILES | CC[C@](C)(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2O/c1-3-10(2,13)7-4-5-8(11)9(12)6-7/h4-6,13H,3H2,1-2H3/t10-/m0/s1 |
| InChIKey | SZFLMSXKIZPHKN-JTQLQIEISA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |