C13H16Cl2O3 — CID 66321487
ethyl 4-(3,4-dichlorophenyl)-4-hydroxypentanoate (PubChem CID 66321487) has the molecular formula C13H16Cl2O3 and a molecular weight of 291.17 g/mol. Its IUPAC name is ethyl 4-(3,4-dichlorophenyl)-4-hydroxypentanoate.
| Compound Name | ethyl 4-(3,4-dichlorophenyl)-4-hydroxypentanoate |
|---|---|
| PubChem CID | 66321487 |
| Molecular Formula | C13H16Cl2O3 |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | ethyl 4-(3,4-dichlorophenyl)-4-hydroxypentanoate |
| SMILES | CCOC(=O)CCC(C)(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2O3/c1-3-18-12(16)6-7-13(2,17)9-4-5-10(14)11(15)8-9/h4-5,8,17H,3,6-7H2,1-2H3 |
| InChIKey | NNMZQETVKOIBOQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |