C11H10ClF3O2 — CID 146013675
ethyl 2-[2-chloro-4-(trifluoromethyl)phenyl]acetate (PubChem CID 146013675) has the molecular formula C11H10ClF3O2 and a molecular weight of 266.65 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-(trifluoromethyl)phenyl]acetate.
| Compound Name | ethyl 2-[2-chloro-4-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 146013675 |
| Molecular Formula | C11H10ClF3O2 |
| Molecular Weight | 266.65 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | ethyl 2-[2-chloro-4-(trifluoromethyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H10ClF3O2/c1-2-17-10(16)5-7-3-4-8(6-9(7)12)11(13,14)15/h3-4,6H,2,5H2,1H3 |
| InChIKey | FLVDAIVZIVKQRD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.65 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |