C20H21F3O3 — CID 70444859
ethyl 2-[4-[1-hydroxy-1-[3-(trifluoromethyl)phenyl]propyl]phenyl]acetate (PubChem CID 70444859) has the molecular formula C20H21F3O3 and a molecular weight of 366.38 g/mol. Its IUPAC name is ethyl 2-[4-[1-hydroxy-1-[3-(trifluoromethyl)phenyl]propyl]phenyl]acetate.
| Compound Name | ethyl 2-[4-[1-hydroxy-1-[3-(trifluoromethyl)phenyl]propyl]phenyl]acetate |
|---|---|
| PubChem CID | 70444859 |
| Molecular Formula | C20H21F3O3 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | ethyl 2-[4-[1-hydroxy-1-[3-(trifluoromethyl)phenyl]propyl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C(O)(CC)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H21F3O3/c1-3-19(25,16-6-5-7-17(13-16)20(21,22)23)15-10-8-14(9-11-15)12-18(24)26-4-2/h5-11,13,25H,3-4,12H2,1-2H3 |
| InChIKey | OZWXIDADZPOARN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |