C11H11ClF3NO4S — CID 3861490
ethyl 2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]acetate (PubChem CID 3861490) has the molecular formula C11H11ClF3NO4S and a molecular weight of 345.73 g/mol. Its IUPAC name is ethyl 2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]acetate.
| Compound Name | ethyl 2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 3861490 |
| Molecular Formula | C11H11ClF3NO4S |
| Molecular Weight | 345.73 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | ethyl 2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]acetate |
| SMILES | CCOC(=O)CNS(=O)(=O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C11H11ClF3NO4S/c1-2-20-10(17)6-16-21(18,19)9-5-7(11(13,14)15)3-4-8(9)12/h3-5,16H,2,6H2,1H3 |
| InChIKey | OATLZQYRGLOJQO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.73 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |