C11H12ClF3N2O3S — CID 3824070
N-[2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]ethyl]acetamide (PubChem CID 3824070) has the molecular formula C11H12ClF3N2O3S and a molecular weight of 344.74 g/mol. Its IUPAC name is N-[2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]ethyl]acetamide.
| Compound Name | N-[2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 3824070 |
| Molecular Formula | C11H12ClF3N2O3S |
| Molecular Weight | 344.74 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | N-[2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNS(=O)(=O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C11H12ClF3N2O3S/c1-7(18)16-4-5-17-21(19,20)10-6-8(11(13,14)15)2-3-9(10)12/h2-3,6,17H,4-5H2,1H3,(H,16,18) |
| InChIKey | LVJCPHRBUSFPBP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.74 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|