C10H10ClF3N2O3S — CID 78785998
2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]propanamide (PubChem CID 78785998) has the molecular formula C10H10ClF3N2O3S and a molecular weight of 330.72 g/mol. Its IUPAC name is 2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]propanamide.
| Compound Name | 2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 78785998 |
| Molecular Formula | C10H10ClF3N2O3S |
| Molecular Weight | 330.72 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
| SMILES | CC(NS(=O)(=O)c1cc(C(F)(F)F)ccc1Cl)C(N)=O |
| InChI | InChI=1S/C10H10ClF3N2O3S/c1-5(9(15)17)16-20(18,19)8-4-6(10(12,13)14)2-3-7(8)11/h2-5,16H,1H3,(H2,15,17) |
| InChIKey | KIQIZMUUSISMFL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.72 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |