C18H17ClF3NO4S — CID 3406154
ethyl 2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]-3-phenylpropanoate (PubChem CID 3406154) has the molecular formula C18H17ClF3NO4S and a molecular weight of 435.85 g/mol. Its IUPAC name is ethyl 2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]-3-phenylpropanoate.
| Compound Name | ethyl 2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 3406154 |
| Molecular Formula | C18H17ClF3NO4S |
| Molecular Weight | 435.85 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | ethyl 2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]-3-phenylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)NS(=O)(=O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C18H17ClF3NO4S/c1-2-27-17(24)15(10-12-6-4-3-5-7-12)23-28(25,26)16-11-13(18(20,21)22)8-9-14(16)19/h3-9,11,15,23H,2,10H2,1H3 |
| InChIKey | ZDGGNPFVOUXJPP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.85 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |