C19H22BrNO4S — CID 3287288
ethyl 2-[(4-bromo-2-ethylphenyl)sulfonylamino]-3-phenylpropanoate (PubChem CID 3287288) has the molecular formula C19H22BrNO4S and a molecular weight of 440.36 g/mol. Its IUPAC name is ethyl 2-[(4-bromo-2-ethylphenyl)sulfonylamino]-3-phenylpropanoate.
| Compound Name | ethyl 2-[(4-bromo-2-ethylphenyl)sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 3287288 |
| Molecular Formula | C19H22BrNO4S |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | ethyl 2-[(4-bromo-2-ethylphenyl)sulfonylamino]-3-phenylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)NS(=O)(=O)c1ccc(Br)cc1CC |
| InChI | InChI=1S/C19H22BrNO4S/c1-3-15-13-16(20)10-11-18(15)26(23,24)21-17(19(22)25-4-2)12-14-8-6-5-7-9-14/h5-11,13,17,21H,3-4,12H2,1-2H3 |
| InChIKey | DNYCMYSAJOZXPO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |