C19H19BrF3NO5S2 — CID 3703624
ethyl 3-benzylsulfanyl-2-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylamino]propanoate (PubChem CID 3703624) has the molecular formula C19H19BrF3NO5S2 and a molecular weight of 542.40 g/mol. Its IUPAC name is ethyl 3-benzylsulfanyl-2-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylamino]propanoate.
| Compound Name | ethyl 3-benzylsulfanyl-2-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 3703624 |
| Molecular Formula | C19H19BrF3NO5S2 |
| Molecular Weight | 542.40 g/mol |
| Exact Mass | 540.98 |
| IUPAC Name | ethyl 3-benzylsulfanyl-2-[[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylamino]propanoate |
| SMILES | CCOC(=O)C(CSCc1ccccc1)NS(=O)(=O)c1ccc(Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C19H19BrF3NO5S2/c1-2-28-18(25)15(12-30-11-13-6-4-3-5-7-13)24-31(26,27)17-9-8-14(20)10-16(17)29-19(21,22)23/h3-10,15,24H,2,11-12H2,1H3 |
| InChIKey | GFQSUQHLSRTBGZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |