C17H16F3NO5S — CID 3840083
ethyl 2-phenyl-2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]acetate (PubChem CID 3840083) has the molecular formula C17H16F3NO5S and a molecular weight of 403.38 g/mol. Its IUPAC name is ethyl 2-phenyl-2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]acetate.
| Compound Name | ethyl 2-phenyl-2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 3840083 |
| Molecular Formula | C17H16F3NO5S |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | ethyl 2-phenyl-2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]acetate |
| SMILES | CCOC(=O)C(NS(=O)(=O)c1ccccc1OC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C17H16F3NO5S/c1-2-25-16(22)15(12-8-4-3-5-9-12)21-27(23,24)14-11-7-6-10-13(14)26-17(18,19)20/h3-11,15,21H,2H2,1H3 |
| InChIKey | GLSOIRIFAKQAIA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |