C22H27F3N2O7S2 — CID 74224203
ethyl (2S)-6-[(4-methylphenyl)sulfonylamino]-2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]hexanoate (PubChem CID 74224203) has the molecular formula C22H27F3N2O7S2 and a molecular weight of 552.59 g/mol. Its IUPAC name is ethyl (2S)-6-[(4-methylphenyl)sulfonylamino]-2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]hexanoate.
| Compound Name | ethyl (2S)-6-[(4-methylphenyl)sulfonylamino]-2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 74224203 |
| Molecular Formula | C22H27F3N2O7S2 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | ethyl (2S)-6-[(4-methylphenyl)sulfonylamino]-2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]hexanoate |
| SMILES | CCOC(=O)[C@H](CCCCNS(=O)(=O)c1ccc(C)cc1)NS(=O)(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C22H27F3N2O7S2/c1-3-33-21(28)18(8-6-7-15-26-35(29,30)17-13-11-16(2)12-14-17)27-36(31,32)20-10-5-4-9-19(20)34-22(23,24)25/h4-5,9-14,18,26-27H,3,6-8,15H2,1-2H3/t18-/m0/s1 |
| InChIKey | ISZUWKYTWGQTDW-SFHVURJKSA-N |
| XLogP | 3.25 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|