C19H31N3O6S — CID 59493498
ethyl (2S)-10-(methylamino)-2-[(2-nitrophenyl)sulfonylamino]decanoate (PubChem CID 59493498) has the molecular formula C19H31N3O6S and a molecular weight of 429.54 g/mol. Its IUPAC name is ethyl (2S)-10-(methylamino)-2-[(2-nitrophenyl)sulfonylamino]decanoate.
| Compound Name | ethyl (2S)-10-(methylamino)-2-[(2-nitrophenyl)sulfonylamino]decanoate |
|---|---|
| PubChem CID | 59493498 |
| Molecular Formula | C19H31N3O6S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | ethyl (2S)-10-(methylamino)-2-[(2-nitrophenyl)sulfonylamino]decanoate |
| SMILES | CCOC(=O)[C@H](CCCCCCCCNC)NS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H31N3O6S/c1-3-28-19(23)16(12-8-6-4-5-7-11-15-20-2)21-29(26,27)18-14-10-9-13-17(18)22(24)25/h9-10,13-14,16,20-21H,3-8,11-12,15H2,1-2H3/t16-/m0/s1 |
| InChIKey | BUBJJNMODWRBKK-INIZCTEOSA-N |
| XLogP | 2.75 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|